C18H20N2O — CID 44568533
(6aR)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-amine (PubChem CID 44568533) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is (6aR)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-amine.
| Compound Name | (6aR)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-amine |
|---|---|
| PubChem CID | 44568533 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | (6aR)-2-methoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-amine |
| SMILES | COc1cc2c3c(c1)-c1c(N)cccc1C[C@H]3N(C)CC2 |
| InChI | InChI=1S/C18H20N2O/c1-20-7-6-12-8-13(21-2)10-14-17-11(4-3-5-15(17)19)9-16(20)18(12)14/h3-5,8,10,16H,6-7,9,19H2,1-2H3/t16-/m1/s1 |
| InChIKey | RHZAGARGKYFZJB-MRXNPFEDSA-N |
| XLogP | 3.03 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|