C26H31ClN4O — CID 44568581
2-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]methyl]-5-[(7-chloroquinolin-4-yl)amino]phenol (PubChem CID 44568581) has the molecular formula C26H31ClN4O and a molecular weight of 451.01 g/mol. Its IUPAC name is 2-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]methyl]-5-[(7-chloroquinolin-4-yl)amino]phenol.
| Compound Name | 2-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]methyl]-5-[(7-chloroquinolin-4-yl)amino]phenol |
|---|---|
| PubChem CID | 44568581 |
| Molecular Formula | C26H31ClN4O |
| Molecular Weight | 451.01 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | 2-[[[(1S,9aR)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methylamino]methyl]-5-[(7-chloroquinolin-4-yl)amino]phenol |
| SMILES | Oc1cc(Nc2ccnc3cc(Cl)ccc23)ccc1CNC[C@@H]1CCCN2CCCC[C@H]12 |
| InChI | InChI=1S/C26H31ClN4O/c27-20-7-9-22-23(10-11-29-24(22)14-20)30-21-8-6-19(26(32)15-21)17-28-16-18-4-3-13-31-12-2-1-5-25(18)31/h6-11,14-15,18,25,28,32H,1-5,12-13,16-17H2,(H,29,30)/t18-,25+/m0/s1 |
| InChIKey | GLKGRDKANRBKOB-AVRWGWEMSA-N |
| XLogP | 5.69 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.01 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|