C39H38N4O5 — CID 44568677
benzyl N-[(5R)-5-benzamido-6-[[(2S)-1-(4-isoquinolin-1-ylphenyl)-3-oxopropan-2-yl]amino]-6-oxohexyl]carbamate (PubChem CID 44568677) has the molecular formula C39H38N4O5 and a molecular weight of 642.76 g/mol. Its IUPAC name is benzyl N-[(5R)-5-benzamido-6-[[(2S)-1-(4-isoquinolin-1-ylphenyl)-3-oxopropan-2-yl]amino]-6-oxohexyl]carbamate.
| Compound Name | benzyl N-[(5R)-5-benzamido-6-[[(2S)-1-(4-isoquinolin-1-ylphenyl)-3-oxopropan-2-yl]amino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 44568677 |
| Molecular Formula | C39H38N4O5 |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.28 |
| IUPAC Name | benzyl N-[(5R)-5-benzamido-6-[[(2S)-1-(4-isoquinolin-1-ylphenyl)-3-oxopropan-2-yl]amino]-6-oxohexyl]carbamate |
| SMILES | O=C[C@H](Cc1ccc(-c2nccc3ccccc23)cc1)NC(=O)[C@@H](CCCCNC(=O)OCc1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C39H38N4O5/c44-26-33(25-28-18-20-31(21-19-28)36-34-16-8-7-13-30(34)22-24-40-36)42-38(46)35(43-37(45)32-14-5-2-6-15-32)17-9-10-23-41-39(47)48-27-29-11-3-1-4-12-29/h1-8,11-16,18-22,24,26,33,35H,9-10,17,23,25,27H2,(H,41,47)(H,42,46)(H,43,45)/t33-,35+/m0/s1 |
| InChIKey | JRQADFMFIKRPAM-QWOOXDRHSA-N |
| XLogP | 6.02 |
| TPSA | 126.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|