About N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine
N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine (PubChem CID 44568820) has the molecular formula C22H23N5O
and a molecular weight of 373.46 g/mol. Its IUPAC name is N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine.
Molecular Properties
| Compound Name | N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine |
| PubChem CID | 44568820 |
| Molecular Formula | C22H23N5O |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine |
| SMILES | Cc1ccc2c(NC3CC3)noc2c1-c1ccc2c(NC(C)C)nncc2c1 |
| InChI | InChI=1S/C22H23N5O/c1-12(2)24-21-17-9-5-14(10-15(17)11-23-26-21)19-13(3)4-8-18-20(19)28-27-22(18)25-16-6-7-16/h4-5,8-12,16H,6-7H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | DYSGCGRDHIJLBK-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine?
The IUPAC name of N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine (CID 44568820) is N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine.
What is the SMILES notation for N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine?
The canonical SMILES for N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine is Cc1ccc2c(NC3CC3)noc2c1-c1ccc2c(NC(C)C)nncc2c1.
What is the InChIKey of N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine?
The InChIKey is DYSGCGRDHIJLBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N5O/c1-12(2)24-21-17-9-5-14(10-15(17)11-23-26-21)19-13(3)4-8-18-20(19)28-27-22(18)25-16-6-7-16/h4-5,8-12,16H,6-7H2,1-3H3,(H,24,26)(H,25,27).
What are the key properties of N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine?
N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine has a molecular weight of 373.46 g/mol, XLogP of 5.14, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-6-methyl-7-[1-(propan-2-ylamino)phthalazin-6-yl]-1,2-benzoxazol-3-amine is sourced from PubChem (CID 44568820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).