C22H25F6NO2 — CID 44568830
2-[4-[butyl-[[3-(2-hydroxyethyl)phenyl]methyl]amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 44568830) has the molecular formula C22H25F6NO2 and a molecular weight of 449.44 g/mol. Its IUPAC name is 2-[4-[butyl-[[3-(2-hydroxyethyl)phenyl]methyl]amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[butyl-[[3-(2-hydroxyethyl)phenyl]methyl]amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 44568830 |
| Molecular Formula | C22H25F6NO2 |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.18 |
| IUPAC Name | 2-[4-[butyl-[[3-(2-hydroxyethyl)phenyl]methyl]amino]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCCCN(Cc1cccc(CCO)c1)c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H25F6NO2/c1-2-3-12-29(15-17-6-4-5-16(14-17)11-13-30)19-9-7-18(8-10-19)20(31,21(23,24)25)22(26,27)28/h4-10,14,30-31H,2-3,11-13,15H2,1H3 |
| InChIKey | YGEIBYBALYPULP-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|