About 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine
4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine (PubChem CID 44568832) has the molecular formula C14H16F2N6
and a molecular weight of 306.32 g/mol. Its IUPAC name is 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
| PubChem CID | 44568832 |
| Molecular Formula | C14H16F2N6 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine |
| SMILES | CN1CCN(c2cc(-c3ccc(F)nc3F)nc(N)n2)CC1 |
| InChI | InChI=1S/C14H16F2N6/c1-21-4-6-22(7-5-21)12-8-10(18-14(17)20-12)9-2-3-11(15)19-13(9)16/h2-3,8H,4-7H2,1H3,(H2,17,18,20) |
| InChIKey | JRUZDFQRGNNPSN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine?
The IUPAC name of 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine (CID 44568832) is 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine.
What is the SMILES notation for 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine?
The canonical SMILES for 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine is CN1CCN(c2cc(-c3ccc(F)nc3F)nc(N)n2)CC1.
What is the InChIKey of 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine?
The InChIKey is JRUZDFQRGNNPSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2N6/c1-21-4-6-22(7-5-21)12-8-10(18-14(17)20-12)9-2-3-11(15)19-13(9)16/h2-3,8H,4-7H2,1H3,(H2,17,18,20).
What are the key properties of 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine?
4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine has a molecular weight of 306.32 g/mol, XLogP of 1.15, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,6-difluoro-3-pyridinyl)-6-(4-methylpiperazin-1-yl)pyrimidin-2-amine is sourced from PubChem (CID 44568832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).