C14H19NO7S2 — CID 44569013
methyl (2S,4R)-1-(4-methylphenyl)sulfonyl-4-methylsulfonyloxypyrrolidine-2-carboxylate (PubChem CID 44569013) has the molecular formula C14H19NO7S2 and a molecular weight of 377.44 g/mol. Its IUPAC name is methyl (2S,4R)-1-(4-methylphenyl)sulfonyl-4-methylsulfonyloxypyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4R)-1-(4-methylphenyl)sulfonyl-4-methylsulfonyloxypyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 44569013 |
| Molecular Formula | C14H19NO7S2 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.06 |
| IUPAC Name | methyl (2S,4R)-1-(4-methylphenyl)sulfonyl-4-methylsulfonyloxypyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H](OS(C)(=O)=O)CN1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H19NO7S2/c1-10-4-6-12(7-5-10)24(19,20)15-9-11(22-23(3,17)18)8-13(15)14(16)21-2/h4-7,11,13H,8-9H2,1-3H3/t11-,13+/m1/s1 |
| InChIKey | XDGPYCILXATFIO-YPMHNXCESA-N |
| XLogP | 0.28 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|