About 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine
2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine (PubChem CID 44569029) has the molecular formula C12H21ClN4
and a molecular weight of 256.78 g/mol. Its IUPAC name is 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine.
Molecular Properties
| Compound Name | 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine |
| PubChem CID | 44569029 |
| Molecular Formula | C12H21ClN4 |
| Molecular Weight | 256.78 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine |
| SMILES | CC(C)CNc1cc(NCC(C)C)nc(Cl)n1 |
| InChI | InChI=1S/C12H21ClN4/c1-8(2)6-14-10-5-11(15-7-9(3)4)17-12(13)16-10/h5,8-9H,6-7H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | ZBTQILQCSFZERZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.78 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine?
The IUPAC name of 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine (CID 44569029) is 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine.
What is the SMILES notation for 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine?
The canonical SMILES for 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine is CC(C)CNc1cc(NCC(C)C)nc(Cl)n1.
What is the InChIKey of 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine?
The InChIKey is ZBTQILQCSFZERZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21ClN4/c1-8(2)6-14-10-5-11(15-7-9(3)4)17-12(13)16-10/h5,8-9H,6-7H2,1-4H3,(H2,14,15,16,17).
What are the key properties of 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine?
2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine has a molecular weight of 256.78 g/mol, XLogP of 3.27, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-N,6-N-bis(2-methylpropyl)pyrimidine-4,6-diamine is sourced from PubChem (CID 44569029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).