C11H14N2O5S — CID 44569082
(2S,4R)-1-(benzenesulfonyl)-N,4-dihydroxypyrrolidine-2-carboxamide (PubChem CID 44569082) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is (2S,4R)-1-(benzenesulfonyl)-N,4-dihydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-(benzenesulfonyl)-N,4-dihydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 44569082 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | (2S,4R)-1-(benzenesulfonyl)-N,4-dihydroxypyrrolidine-2-carboxamide |
| SMILES | O=C(NO)[C@@H]1C[C@@H](O)CN1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O5S/c14-8-6-10(11(15)12-16)13(7-8)19(17,18)9-4-2-1-3-5-9/h1-5,8,10,14,16H,6-7H2,(H,12,15)/t8-,10+/m1/s1 |
| InChIKey | JTEZZZAMYIVVNR-SCZZXKLOSA-N |
| XLogP | -0.68 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|