C23H25N5 — CID 44569106
6-N-butyl-6-N-(naphthalen-2-ylmethyl)quinazoline-2,4,6-triamine (PubChem CID 44569106) has the molecular formula C23H25N5 and a molecular weight of 371.49 g/mol. Its IUPAC name is 6-N-butyl-6-N-(naphthalen-2-ylmethyl)quinazoline-2,4,6-triamine.
| Compound Name | 6-N-butyl-6-N-(naphthalen-2-ylmethyl)quinazoline-2,4,6-triamine |
|---|---|
| PubChem CID | 44569106 |
| Molecular Formula | C23H25N5 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 6-N-butyl-6-N-(naphthalen-2-ylmethyl)quinazoline-2,4,6-triamine |
| SMILES | CCCCN(Cc1ccc2ccccc2c1)c1ccc2nc(N)nc(N)c2c1 |
| InChI | InChI=1S/C23H25N5/c1-2-3-12-28(15-16-8-9-17-6-4-5-7-18(17)13-16)19-10-11-21-20(14-19)22(24)27-23(25)26-21/h4-11,13-14H,2-3,12,15H2,1H3,(H4,24,25,26,27) |
| InChIKey | XROWQZMGTMLPOY-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |