C33H40ClN3O5S — CID 44569217
2-chloro-N-[[4-[3-(decylcarbamoyl)phenyl]sulfanylphenyl]carbamoyl]-3,4-dimethoxybenzamide (PubChem CID 44569217) has the molecular formula C33H40ClN3O5S and a molecular weight of 626.22 g/mol. Its IUPAC name is 2-chloro-N-[[4-[3-(decylcarbamoyl)phenyl]sulfanylphenyl]carbamoyl]-3,4-dimethoxybenzamide.
| Compound Name | 2-chloro-N-[[4-[3-(decylcarbamoyl)phenyl]sulfanylphenyl]carbamoyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 44569217 |
| Molecular Formula | C33H40ClN3O5S |
| Molecular Weight | 626.22 g/mol |
| Exact Mass | 625.24 |
| IUPAC Name | 2-chloro-N-[[4-[3-(decylcarbamoyl)phenyl]sulfanylphenyl]carbamoyl]-3,4-dimethoxybenzamide |
| SMILES | CCCCCCCCCCNC(=O)c1cccc(Sc2ccc(NC(=O)NC(=O)c3ccc(OC)c(OC)c3Cl)cc2)c1 |
| InChI | InChI=1S/C33H40ClN3O5S/c1-4-5-6-7-8-9-10-11-21-35-31(38)23-13-12-14-26(22-23)43-25-17-15-24(16-18-25)36-33(40)37-32(39)27-19-20-28(41-2)30(42-3)29(27)34/h12-20,22H,4-11,21H2,1-3H3,(H,35,38)(H2,36,37,39,40) |
| InChIKey | TXMSTQMORLZENZ-UHFFFAOYSA-N |
| XLogP | 8.34 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.22 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|