C17H16Cl2FNO3S — CID 44569557
N-[(3-chloro-4-fluorophenyl)methyl]-2-(4-chlorophenyl)sulfonyl-2-methylpropanamide (PubChem CID 44569557) has the molecular formula C17H16Cl2FNO3S and a molecular weight of 404.29 g/mol. Its IUPAC name is N-[(3-chloro-4-fluorophenyl)methyl]-2-(4-chlorophenyl)sulfonyl-2-methylpropanamide.
| Compound Name | N-[(3-chloro-4-fluorophenyl)methyl]-2-(4-chlorophenyl)sulfonyl-2-methylpropanamide |
|---|---|
| PubChem CID | 44569557 |
| Molecular Formula | C17H16Cl2FNO3S |
| Molecular Weight | 404.29 g/mol |
| Exact Mass | 403.02 |
| IUPAC Name | N-[(3-chloro-4-fluorophenyl)methyl]-2-(4-chlorophenyl)sulfonyl-2-methylpropanamide |
| SMILES | CC(C)(C(=O)NCc1ccc(F)c(Cl)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16Cl2FNO3S/c1-17(2,25(23,24)13-6-4-12(18)5-7-13)16(22)21-10-11-3-8-15(20)14(19)9-11/h3-9H,10H2,1-2H3,(H,21,22) |
| InChIKey | IXKFOAYMHDSEDQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.29 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |