C22H16N4O4 — CID 44569559
(1S,12R,13R,17S)-12-methyl-15-phenyl-2,10,15,19-tetrazapentacyclo[10.5.2.02,11.04,9.013,17]nonadeca-4,6,8,10-tetraene-3,14,16,18-tetrone (PubChem CID 44569559) has the molecular formula C22H16N4O4 and a molecular weight of 400.39 g/mol. Its IUPAC name is (1S,12R,13R,17S)-12-methyl-15-phenyl-2,10,15,19-tetrazapentacyclo[10.5.2.02,11.04,9.013,17]nonadeca-4,6,8,10-tetraene-3,14,16,18-tetrone.
| Compound Name | (1S,12R,13R,17S)-12-methyl-15-phenyl-2,10,15,19-tetrazapentacyclo[10.5.2.02,11.04,9.013,17]nonadeca-4,6,8,10-tetraene-3,14,16,18-tetrone |
|---|---|
| PubChem CID | 44569559 |
| Molecular Formula | C22H16N4O4 |
| Molecular Weight | 400.39 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | (1S,12R,13R,17S)-12-methyl-15-phenyl-2,10,15,19-tetrazapentacyclo[10.5.2.02,11.04,9.013,17]nonadeca-4,6,8,10-tetraene-3,14,16,18-tetrone |
| SMILES | C[C@@]12NC(=O)[C@H]([C@H]3C(=O)N(c4ccccc4)C(=O)[C@H]31)n1c2nc2ccccc2c1=O |
| InChI | InChI=1S/C22H16N4O4/c1-22-15-14(19(29)25(20(15)30)11-7-3-2-4-8-11)16(17(27)24-22)26-18(28)12-9-5-6-10-13(12)23-21(22)26/h2-10,14-16H,1H3,(H,24,27)/t14-,15-,16-,22+/m0/s1 |
| InChIKey | LCFDOKKMAKVAMZ-FENNVDPPSA-N |
| XLogP | 1.10 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|