C18H18N2O3S5 — CID 44569595
3-[(2Z)-2-[(2E)-2-[3-prop-2-enyl-2,4-bis(sulfanylidene)-1,3-thiazolidin-5-ylidene]ethylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid (PubChem CID 44569595) has the molecular formula C18H18N2O3S5 and a molecular weight of 470.69 g/mol. Its IUPAC name is 3-[(2Z)-2-[(2E)-2-[3-prop-2-enyl-2,4-bis(sulfanylidene)-1,3-thiazolidin-5-ylidene]ethylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[(2Z)-2-[(2E)-2-[3-prop-2-enyl-2,4-bis(sulfanylidene)-1,3-thiazolidin-5-ylidene]ethylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 44569595 |
| Molecular Formula | C18H18N2O3S5 |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 469.99 |
| IUPAC Name | 3-[(2Z)-2-[(2E)-2-[3-prop-2-enyl-2,4-bis(sulfanylidene)-1,3-thiazolidin-5-ylidene]ethylidene]-1,3-benzothiazol-3-yl]propane-1-sulfonic acid |
| SMILES | C=CCN1C(=S)S/C(=C/C=C2\Sc3ccccc3N2CCCS(=O)(=O)O)C1=S |
| InChI | InChI=1S/C18H18N2O3S5/c1-2-10-20-17(24)15(27-18(20)25)8-9-16-19(11-5-12-28(21,22)23)13-6-3-4-7-14(13)26-16/h2-4,6-9H,1,5,10-12H2,(H,21,22,23)/b15-8+,16-9- |
| InChIKey | NYMYOZAOTKGZHE-MICXRRPDSA-N |
| XLogP | 4.45 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|