C11H13F3O2S — CID 44569912
1,1,1-trifluoro-3-(2-phenylethylsulfanyl)propane-2,2-diol (PubChem CID 44569912) has the molecular formula C11H13F3O2S and a molecular weight of 266.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(2-phenylethylsulfanyl)propane-2,2-diol.
| Compound Name | 1,1,1-trifluoro-3-(2-phenylethylsulfanyl)propane-2,2-diol |
|---|---|
| PubChem CID | 44569912 |
| Molecular Formula | C11H13F3O2S |
| Molecular Weight | 266.28 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 1,1,1-trifluoro-3-(2-phenylethylsulfanyl)propane-2,2-diol |
| SMILES | OC(O)(CSCCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H13F3O2S/c12-11(13,14)10(15,16)8-17-7-6-9-4-2-1-3-5-9/h1-5,15-16H,6-8H2 |
| InChIKey | WJMZDJFZWPVFBV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.28 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|