C23H27N5O3 — CID 44570022
2-[2-(2-butoxyethoxy)ethoxy]-5-[5-(2-methyl-4-pyridinyl)-1H-1,2,4-triazol-3-yl]benzonitrile (PubChem CID 44570022) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[2-(2-butoxyethoxy)ethoxy]-5-[5-(2-methyl-4-pyridinyl)-1H-1,2,4-triazol-3-yl]benzonitrile.
| Compound Name | 2-[2-(2-butoxyethoxy)ethoxy]-5-[5-(2-methyl-4-pyridinyl)-1H-1,2,4-triazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 44570022 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-[2-(2-butoxyethoxy)ethoxy]-5-[5-(2-methyl-4-pyridinyl)-1H-1,2,4-triazol-3-yl]benzonitrile |
| SMILES | CCCCOCCOCCOc1ccc(-c2n[nH]c(-c3ccnc(C)c3)n2)cc1C#N |
| InChI | InChI=1S/C23H27N5O3/c1-3-4-9-29-10-11-30-12-13-31-21-6-5-18(15-20(21)16-24)22-26-23(28-27-22)19-7-8-25-17(2)14-19/h5-8,14-15H,3-4,9-13H2,1-2H3,(H,26,27,28) |
| InChIKey | SHHGIDGANXEHNK-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|