C21H22ClN5O3 — CID 44570023
2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-5-[5-(2-methyl-4-pyridinyl)-1H-1,2,4-triazol-3-yl]benzonitrile (PubChem CID 44570023) has the molecular formula C21H22ClN5O3 and a molecular weight of 427.89 g/mol. Its IUPAC name is 2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-5-[5-(2-methyl-4-pyridinyl)-1H-1,2,4-triazol-3-yl]benzonitrile.
| Compound Name | 2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-5-[5-(2-methyl-4-pyridinyl)-1H-1,2,4-triazol-3-yl]benzonitrile |
|---|---|
| PubChem CID | 44570023 |
| Molecular Formula | C21H22ClN5O3 |
| Molecular Weight | 427.89 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-[2-[2-(2-chloroethoxy)ethoxy]ethoxy]-5-[5-(2-methyl-4-pyridinyl)-1H-1,2,4-triazol-3-yl]benzonitrile |
| SMILES | Cc1cc(-c2nc(-c3ccc(OCCOCCOCCCl)c(C#N)c3)n[nH]2)ccn1 |
| InChI | InChI=1S/C21H22ClN5O3/c1-15-12-17(4-6-24-15)21-25-20(26-27-21)16-2-3-19(18(13-16)14-23)30-11-10-29-9-8-28-7-5-22/h2-4,6,12-13H,5,7-11H2,1H3,(H,25,26,27) |
| InChIKey | UUDPYLGOWACYPG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 105.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.89 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|