About 3-[3-(dimethylamino)butyl]-1,1-dimethylurea
3-[3-(dimethylamino)butyl]-1,1-dimethylurea (PubChem CID 44570098) has the molecular formula C9H21N3O
and a molecular weight of 187.29 g/mol. Its IUPAC name is 3-[3-(dimethylamino)butyl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[3-(dimethylamino)butyl]-1,1-dimethylurea |
| PubChem CID | 44570098 |
| Molecular Formula | C9H21N3O |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.17 |
| IUPAC Name | 3-[3-(dimethylamino)butyl]-1,1-dimethylurea |
| SMILES | CC(CCNC(=O)N(C)C)N(C)C |
| InChI | InChI=1S/C9H21N3O/c1-8(11(2)3)6-7-10-9(13)12(4)5/h8H,6-7H2,1-5H3,(H,10,13) |
| InChIKey | AFIPYFBOMRKAPT-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[3-(dimethylamino)butyl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-(dimethylamino)butyl]-1,1-dimethylurea?
The IUPAC name of 3-[3-(dimethylamino)butyl]-1,1-dimethylurea (CID 44570098) is 3-[3-(dimethylamino)butyl]-1,1-dimethylurea.
What is the SMILES notation for 3-[3-(dimethylamino)butyl]-1,1-dimethylurea?
The canonical SMILES for 3-[3-(dimethylamino)butyl]-1,1-dimethylurea is CC(CCNC(=O)N(C)C)N(C)C.
What is the InChIKey of 3-[3-(dimethylamino)butyl]-1,1-dimethylurea?
The InChIKey is AFIPYFBOMRKAPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3O/c1-8(11(2)3)6-7-10-9(13)12(4)5/h8H,6-7H2,1-5H3,(H,10,13).
What are the key properties of 3-[3-(dimethylamino)butyl]-1,1-dimethylurea?
3-[3-(dimethylamino)butyl]-1,1-dimethylurea has a molecular weight of 187.29 g/mol, XLogP of 0.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-(dimethylamino)butyl]-1,1-dimethylurea is sourced from PubChem (CID 44570098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).