C14H22N2O2 — CID 44570103
[3-(dimethylamino)-3-phenylpropyl] N,N-dimethylcarbamate (PubChem CID 44570103) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is [3-(dimethylamino)-3-phenylpropyl] N,N-dimethylcarbamate.
| Compound Name | [3-(dimethylamino)-3-phenylpropyl] N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 44570103 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | [3-(dimethylamino)-3-phenylpropyl] N,N-dimethylcarbamate |
| SMILES | CN(C)C(=O)OCCC(c1ccccc1)N(C)C |
| InChI | InChI=1S/C14H22N2O2/c1-15(2)13(12-8-6-5-7-9-12)10-11-18-14(17)16(3)4/h5-9,13H,10-11H2,1-4H3 |
| InChIKey | ADOOJVSLMGFMTK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |