C31H39N5O2 — CID 44570112
[3-[4-[[(3R,5S)-3,5-dimethylpiperazin-1-yl]methyl]phenyl]-2-pyridinyl]-[4-(4-methoxyanilino)piperidin-1-yl]methanone (PubChem CID 44570112) has the molecular formula C31H39N5O2 and a molecular weight of 513.69 g/mol. Its IUPAC name is [3-[4-[[(3R,5S)-3,5-dimethylpiperazin-1-yl]methyl]phenyl]-2-pyridinyl]-[4-(4-methoxyanilino)piperidin-1-yl]methanone.
| Compound Name | [3-[4-[[(3R,5S)-3,5-dimethylpiperazin-1-yl]methyl]phenyl]-2-pyridinyl]-[4-(4-methoxyanilino)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 44570112 |
| Molecular Formula | C31H39N5O2 |
| Molecular Weight | 513.69 g/mol |
| Exact Mass | 513.31 |
| IUPAC Name | [3-[4-[[(3R,5S)-3,5-dimethylpiperazin-1-yl]methyl]phenyl]-2-pyridinyl]-[4-(4-methoxyanilino)piperidin-1-yl]methanone |
| SMILES | COc1ccc(NC2CCN(C(=O)c3ncccc3-c3ccc(CN4C[C@@H](C)N[C@@H](C)C4)cc3)CC2)cc1 |
| InChI | InChI=1S/C31H39N5O2/c1-22-19-35(20-23(2)33-22)21-24-6-8-25(9-7-24)29-5-4-16-32-30(29)31(37)36-17-14-27(15-18-36)34-26-10-12-28(38-3)13-11-26/h4-13,16,22-23,27,33-34H,14-15,17-21H2,1-3H3/t22-,23+ |
| InChIKey | QUZMHKMZOAKUDI-ZRZAMGCNSA-N |
| XLogP | 4.66 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.69 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|