C29H48O5 — CID 44570200
(1R,2R,3R)-5-[(Z)-2-[(1R,3aR,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-2-(3-hydroxypropoxy)cyclohex-4-ene-1,3-diol (PubChem CID 44570200) has the molecular formula C29H48O5 and a molecular weight of 476.70 g/mol. Its IUPAC name is (1R,2R,3R)-5-[(Z)-2-[(1R,3aR,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-2-(3-hydroxypropoxy)cyclohex-4-ene-1,3-diol.
| Compound Name | (1R,2R,3R)-5-[(Z)-2-[(1R,3aR,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-2-(3-hydroxypropoxy)cyclohex-4-ene-1,3-diol |
|---|---|
| PubChem CID | 44570200 |
| Molecular Formula | C29H48O5 |
| Molecular Weight | 476.70 g/mol |
| Exact Mass | 476.35 |
| IUPAC Name | (1R,2R,3R)-5-[(Z)-2-[(1R,3aR,7aR)-1-[(2R)-6-hydroxy-6-methylheptan-2-yl]-7a-methyl-1,2,3,3a,6,7-hexahydroinden-4-yl]ethenyl]-2-(3-hydroxypropoxy)cyclohex-4-ene-1,3-diol |
| SMILES | C[C@H](CCCC(C)(C)O)[C@H]1CC[C@H]2C(/C=C\C3=C[C@@H](O)[C@H](OCCCO)C(O)C3)=CCC[C@]12C |
| InChI | InChI=1S/C29H48O5/c1-20(8-5-14-28(2,3)33)23-12-13-24-22(9-6-15-29(23,24)4)11-10-21-18-25(31)27(26(32)19-21)34-17-7-16-30/h9-11,18,20,23-27,30-33H,5-8,12-17,19H2,1-4H3/b11-10-/t20-,23-,24+,25-,26?,27+,29-/m1/s1 |
| InChIKey | IJKZNHLEQHEHRO-NLSMBFKTSA-N |
| XLogP | 4.69 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.70 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|