About (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one
(2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one (PubChem CID 44570284) has the molecular formula C14H11NO2
and a molecular weight of 225.25 g/mol. Its IUPAC name is (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one |
| PubChem CID | 44570284 |
| Molecular Formula | C14H11NO2 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CC[C@H](c2ccnc3ccccc23)O1 |
| InChI | InChI=1S/C14H11NO2/c16-14-7-3-6-13(17-14)11-8-9-15-12-5-2-1-4-10(11)12/h1-5,7-9,13H,6H2/t13-/m1/s1 |
| InChIKey | UPIABDYRGTWZKX-CYBMUJFWSA-N |
| XLogP | 2.78 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one?
The IUPAC name of (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one (CID 44570284) is (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one.
What is the SMILES notation for (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one?
The canonical SMILES for (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one is O=C1C=CC[C@H](c2ccnc3ccccc23)O1.
What is the InChIKey of (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one?
The InChIKey is UPIABDYRGTWZKX-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H11NO2/c16-14-7-3-6-13(17-14)11-8-9-15-12-5-2-1-4-10(11)12/h1-5,7-9,13H,6H2/t13-/m1/s1.
What are the key properties of (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one?
(2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one has a molecular weight of 225.25 g/mol, XLogP of 2.78, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-quinolin-4-yl-2,3-dihydropyran-6-one is sourced from PubChem (CID 44570284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).