About 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole
7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole (PubChem CID 44570402) has the molecular formula C16H11ClN2S
and a molecular weight of 298.80 g/mol. Its IUPAC name is 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole.
Molecular Properties
| Compound Name | 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole |
| PubChem CID | 44570402 |
| Molecular Formula | C16H11ClN2S |
| Molecular Weight | 298.80 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole |
| SMILES | Clc1ccc2c(c1)SCc1cnn(-c3ccccc3)c1-2 |
| InChI | InChI=1S/C16H11ClN2S/c17-12-6-7-14-15(8-12)20-10-11-9-18-19(16(11)14)13-4-2-1-3-5-13/h1-9H,10H2 |
| InChIKey | ISWAYVOICLDYON-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.80 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole?
The IUPAC name of 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole (CID 44570402) is 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole.
What is the SMILES notation for 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole?
The canonical SMILES for 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole is Clc1ccc2c(c1)SCc1cnn(-c3ccccc3)c1-2.
What is the InChIKey of 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole?
The InChIKey is ISWAYVOICLDYON-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2S/c17-12-6-7-14-15(8-12)20-10-11-9-18-19(16(11)14)13-4-2-1-3-5-13/h1-9H,10H2.
What are the key properties of 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole?
7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole has a molecular weight of 298.80 g/mol, XLogP of 4.80, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-1-phenyl-4H-thiochromeno[3,4-d]pyrazole is sourced from PubChem (CID 44570402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).