About [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate
[(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate (PubChem CID 44570588) has the molecular formula C17H20ClNO4
and a molecular weight of 337.80 g/mol. Its IUPAC name is [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate.
Molecular Properties
| Compound Name | [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate |
| PubChem CID | 44570588 |
| Molecular Formula | C17H20ClNO4 |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate |
| SMILES | CC(=O)O[C@@H]1CC2C[C@H](OC(=O)c3ccc(Cl)cc3)CC1N2C |
| InChI | InChI=1S/C17H20ClNO4/c1-10(20)22-16-8-13-7-14(9-15(16)19(13)2)23-17(21)11-3-5-12(18)6-4-11/h3-6,13-16H,7-9H2,1-2H3/t13?,14-,15?,16+/m0/s1 |
| InChIKey | CWRGICDKIVZZFB-BHDPWAOGSA-N |
| XLogP | 2.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate?
The IUPAC name of [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate (CID 44570588) is [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate.
What is the SMILES notation for [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate?
The canonical SMILES for [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate is CC(=O)O[C@@H]1CC2C[C@H](OC(=O)c3ccc(Cl)cc3)CC1N2C.
What is the InChIKey of [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate?
The InChIKey is CWRGICDKIVZZFB-BHDPWAOGSA-N. The full InChI is InChI=1S/C17H20ClNO4/c1-10(20)22-16-8-13-7-14(9-15(16)19(13)2)23-17(21)11-3-5-12(18)6-4-11/h3-6,13-16H,7-9H2,1-2H3/t13?,14-,15?,16+/m0/s1.
What are the key properties of [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate?
[(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate has a molecular weight of 337.80 g/mol, XLogP of 2.66, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,6R)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-chlorobenzoate is sourced from PubChem (CID 44570588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).