About [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate
[(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate (PubChem CID 44570618) has the molecular formula C17H20N2O6
and a molecular weight of 348.36 g/mol. Its IUPAC name is [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate.
Molecular Properties
| Compound Name | [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate |
| PubChem CID | 44570618 |
| Molecular Formula | C17H20N2O6 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate |
| SMILES | CC(=O)O[C@H]1CC2C[C@@H](OC(=O)c3ccc([N+](=O)[O-])cc3)CC1N2C |
| InChI | InChI=1S/C17H20N2O6/c1-10(20)24-16-8-13-7-14(9-15(16)18(13)2)25-17(21)11-3-5-12(6-4-11)19(22)23/h3-6,13-16H,7-9H2,1-2H3/t13?,14-,15?,16+/m1/s1 |
| InChIKey | TUZGSZRCHIXFHP-KNIAUWFNSA-N |
| XLogP | 1.92 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate?
The IUPAC name of [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate (CID 44570618) is [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate.
What is the SMILES notation for [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate?
The canonical SMILES for [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate is CC(=O)O[C@H]1CC2C[C@@H](OC(=O)c3ccc([N+](=O)[O-])cc3)CC1N2C.
What is the InChIKey of [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate?
The InChIKey is TUZGSZRCHIXFHP-KNIAUWFNSA-N. The full InChI is InChI=1S/C17H20N2O6/c1-10(20)24-16-8-13-7-14(9-15(16)18(13)2)25-17(21)11-3-5-12(6-4-11)19(22)23/h3-6,13-16H,7-9H2,1-2H3/t13?,14-,15?,16+/m1/s1.
What are the key properties of [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate?
[(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate has a molecular weight of 348.36 g/mol, XLogP of 1.92, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,6S)-6-acetyloxy-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] 4-nitrobenzoate is sourced from PubChem (CID 44570618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).