C16H17NO2 — CID 44570662
(9R)-3-methyl-9-prop-1-en-2-yl-7,8,9,10-tetrahydropyrano[4,3-c]isoquinolin-1-one (PubChem CID 44570662) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (9R)-3-methyl-9-prop-1-en-2-yl-7,8,9,10-tetrahydropyrano[4,3-c]isoquinolin-1-one.
| Compound Name | (9R)-3-methyl-9-prop-1-en-2-yl-7,8,9,10-tetrahydropyrano[4,3-c]isoquinolin-1-one |
|---|---|
| PubChem CID | 44570662 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (9R)-3-methyl-9-prop-1-en-2-yl-7,8,9,10-tetrahydropyrano[4,3-c]isoquinolin-1-one |
| SMILES | C=C(C)[C@@H]1CCc2cnc3cc(C)oc(=O)c3c2C1 |
| InChI | InChI=1S/C16H17NO2/c1-9(2)11-4-5-12-8-17-14-6-10(3)19-16(18)15(14)13(12)7-11/h6,8,11H,1,4-5,7H2,2-3H3/t11-/m1/s1 |
| InChIKey | FYHXOOBGLYFJIC-LLVKDONJSA-N |
| XLogP | 3.18 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|