C21H35N — CID 44570709
N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]cyclohexanamine (PubChem CID 44570709) has the molecular formula C21H35N and a molecular weight of 301.52 g/mol. Its IUPAC name is N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]cyclohexanamine.
| Compound Name | N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]cyclohexanamine |
|---|---|
| PubChem CID | 44570709 |
| Molecular Formula | C21H35N |
| Molecular Weight | 301.52 g/mol |
| Exact Mass | 301.28 |
| IUPAC Name | N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]cyclohexanamine |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)CNC2CCCCC2)C[C@H]1C(=C)C |
| InChI | InChI=1S/C21H35N/c1-6-21(5)13-12-18(14-20(21)16(2)3)17(4)15-22-19-10-8-7-9-11-19/h6,18-20,22H,1-2,4,7-15H2,3,5H3/t18-,20+,21-/m1/s1 |
| InChIKey | AUSKUTBIKIWYDF-HLAWJBBLSA-N |
| XLogP | 5.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.52 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|