C23H39N — CID 44570710
N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]cyclooctanamine (PubChem CID 44570710) has the molecular formula C23H39N and a molecular weight of 329.57 g/mol. Its IUPAC name is N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]cyclooctanamine.
| Compound Name | N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]cyclooctanamine |
|---|---|
| PubChem CID | 44570710 |
| Molecular Formula | C23H39N |
| Molecular Weight | 329.57 g/mol |
| Exact Mass | 329.31 |
| IUPAC Name | N-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]cyclooctanamine |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)CNC2CCCCCCC2)C[C@H]1C(=C)C |
| InChI | InChI=1S/C23H39N/c1-6-23(5)15-14-20(16-22(23)18(2)3)19(4)17-24-21-12-10-8-7-9-11-13-21/h6,20-22,24H,1-2,4,7-17H2,3,5H3/t20-,22+,23-/m1/s1 |
| InChIKey | QPWCMNSBBOJSMR-AKIFATBCSA-N |
| XLogP | 6.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.57 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|