C28H33ClN6O3S — CID 44570771
N-[(1R,2S,5S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-5-(pyrrolidine-1-carbonyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide (PubChem CID 44570771) has the molecular formula C28H33ClN6O3S and a molecular weight of 569.13 g/mol. Its IUPAC name is N-[(1R,2S,5S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-5-(pyrrolidine-1-carbonyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide.
| Compound Name | N-[(1R,2S,5S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-5-(pyrrolidine-1-carbonyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 44570771 |
| Molecular Formula | C28H33ClN6O3S |
| Molecular Weight | 569.13 g/mol |
| Exact Mass | 568.20 |
| IUPAC Name | N-[(1R,2S,5S)-2-[(5-chloro-1H-indole-2-carbonyl)amino]-5-(pyrrolidine-1-carbonyl)cyclohexyl]-5-methyl-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-2-carboxamide |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N4CCCC4)CC[C@@H]3NC(=O)c3cc4cc(Cl)ccc4[nH]3)sc2C1 |
| InChI | InChI=1S/C28H33ClN6O3S/c1-34-11-8-21-24(15-34)39-27(33-21)26(37)32-22-13-16(28(38)35-9-2-3-10-35)4-6-20(22)31-25(36)23-14-17-12-18(29)5-7-19(17)30-23/h5,7,12,14,16,20,22,30H,2-4,6,8-11,13,15H2,1H3,(H,31,36)(H,32,37)/t16-,20-,22+/m0/s1 |
| InChIKey | AEYXIKDIKWBAPI-XUEUYAKLSA-N |
| XLogP | 3.59 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.13 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |