C18H26N2 — CID 44570773
1-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]imidazole (PubChem CID 44570773) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 1-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]imidazole.
| Compound Name | 1-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]imidazole |
|---|---|
| PubChem CID | 44570773 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 1-[2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]prop-2-enyl]imidazole |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)Cn2ccnc2)C[C@H]1C(=C)C |
| InChI | InChI=1S/C18H26N2/c1-6-18(5)8-7-16(11-17(18)14(2)3)15(4)12-20-10-9-19-13-20/h6,9-10,13,16-17H,1-2,4,7-8,11-12H2,3,5H3/t16-,17+,18-/m1/s1 |
| InChIKey | VPNLVOGJYYOARN-FGTMMUONSA-N |
| XLogP | 4.62 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|