C19H33N — CID 44570774
2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]-N,N-diethylprop-2-en-1-amine (PubChem CID 44570774) has the molecular formula C19H33N and a molecular weight of 275.48 g/mol. Its IUPAC name is 2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]-N,N-diethylprop-2-en-1-amine.
| Compound Name | 2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]-N,N-diethylprop-2-en-1-amine |
|---|---|
| PubChem CID | 44570774 |
| Molecular Formula | C19H33N |
| Molecular Weight | 275.48 g/mol |
| Exact Mass | 275.26 |
| IUPAC Name | 2-[(1R,3S,4S)-4-ethenyl-4-methyl-3-prop-1-en-2-ylcyclohexyl]-N,N-diethylprop-2-en-1-amine |
| SMILES | C=C[C@]1(C)CC[C@@H](C(=C)CN(CC)CC)C[C@H]1C(=C)C |
| InChI | InChI=1S/C19H33N/c1-8-19(7)12-11-17(13-18(19)15(4)5)16(6)14-20(9-2)10-3/h8,17-18H,1,4,6,9-14H2,2-3,5,7H3/t17-,18+,19-/m1/s1 |
| InChIKey | SSLYKOZLNJMUCR-CEXWTWQISA-N |
| XLogP | 5.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|