C24H22N6OS — CID 44570808
N-(2-aminophenyl)-4-[[[4-(6-methylsulfanyl-3-pyridinyl)pyrimidin-2-yl]amino]methyl]benzamide (PubChem CID 44570808) has the molecular formula C24H22N6OS and a molecular weight of 442.55 g/mol. Its IUPAC name is N-(2-aminophenyl)-4-[[[4-(6-methylsulfanyl-3-pyridinyl)pyrimidin-2-yl]amino]methyl]benzamide.
| Compound Name | N-(2-aminophenyl)-4-[[[4-(6-methylsulfanyl-3-pyridinyl)pyrimidin-2-yl]amino]methyl]benzamide |
|---|---|
| PubChem CID | 44570808 |
| Molecular Formula | C24H22N6OS |
| Molecular Weight | 442.55 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | N-(2-aminophenyl)-4-[[[4-(6-methylsulfanyl-3-pyridinyl)pyrimidin-2-yl]amino]methyl]benzamide |
| SMILES | CSc1ccc(-c2ccnc(NCc3ccc(C(=O)Nc4ccccc4N)cc3)n2)cn1 |
| InChI | InChI=1S/C24H22N6OS/c1-32-22-11-10-18(15-27-22)20-12-13-26-24(30-20)28-14-16-6-8-17(9-7-16)23(31)29-21-5-3-2-4-19(21)25/h2-13,15H,14,25H2,1H3,(H,29,31)(H,26,28,30) |
| InChIKey | KKJKHBRDXSWOJW-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 105.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.55 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|