About 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide
4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 44571330) has the molecular formula C19H19N3O4
and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide |
| PubChem CID | 44571330 |
| Molecular Formula | C19H19N3O4 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CN2C(=O)CNC(=O)[C@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C19H19N3O4/c23-17-11-20-19(25)16(10-13-4-2-1-3-5-13)22(17)12-14-6-8-15(9-7-14)18(24)21-26/h1-9,16,26H,10-12H2,(H,20,25)(H,21,24)/t16-/m1/s1 |
| InChIKey | BAGHRWNLKMAZMR-MRXNPFEDSA-N |
| XLogP | 0.88 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide?
The IUPAC name of 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide (CID 44571330) is 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide.
What is the SMILES notation for 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide?
The canonical SMILES for 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide is O=C(NO)c1ccc(CN2C(=O)CNC(=O)[C@H]2Cc2ccccc2)cc1.
What is the InChIKey of 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide?
The InChIKey is BAGHRWNLKMAZMR-MRXNPFEDSA-N. The full InChI is InChI=1S/C19H19N3O4/c23-17-11-20-19(25)16(10-13-4-2-1-3-5-13)22(17)12-14-6-8-15(9-7-14)18(24)21-26/h1-9,16,26H,10-12H2,(H,20,25)(H,21,24)/t16-/m1/s1.
What are the key properties of 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide?
4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide has a molecular weight of 353.38 g/mol, XLogP of 0.88, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2R)-2-benzyl-3,6-dioxopiperazin-1-yl]methyl]-N-hydroxybenzamide is sourced from PubChem (CID 44571330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).