About 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide
4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 44571332) has the molecular formula C17H17N3O4S
and a molecular weight of 359.41 g/mol. Its IUPAC name is 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide |
| PubChem CID | 44571332 |
| Molecular Formula | C17H17N3O4S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(CN2C(=O)CNC(=O)[C@H]2Cc2cccs2)cc1 |
| InChI | InChI=1S/C17H17N3O4S/c21-15-9-18-17(23)14(8-13-2-1-7-25-13)20(15)10-11-3-5-12(6-4-11)16(22)19-24/h1-7,14,24H,8-10H2,(H,18,23)(H,19,22)/t14-/m1/s1 |
| InChIKey | MLRJDCCBCWNZMV-CQSZACIVSA-N |
| XLogP | 0.94 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide?
The IUPAC name of 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide (CID 44571332) is 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide.
What is the SMILES notation for 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide?
The canonical SMILES for 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide is O=C(NO)c1ccc(CN2C(=O)CNC(=O)[C@H]2Cc2cccs2)cc1.
What is the InChIKey of 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide?
The InChIKey is MLRJDCCBCWNZMV-CQSZACIVSA-N. The full InChI is InChI=1S/C17H17N3O4S/c21-15-9-18-17(23)14(8-13-2-1-7-25-13)20(15)10-11-3-5-12(6-4-11)16(22)19-24/h1-7,14,24H,8-10H2,(H,18,23)(H,19,22)/t14-/m1/s1.
What are the key properties of 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide?
4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide has a molecular weight of 359.41 g/mol, XLogP of 0.94, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2R)-3,6-dioxo-2-(thiophen-2-ylmethyl)piperazin-1-yl]methyl]-N-hydroxybenzamide is sourced from PubChem (CID 44571332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).