C25H22Cl2F2N2O4S — CID 44571355
(E)-3-[1-[(2,3-dichlorophenyl)methyl]-3a-methyl-2-oxo-3,4,5,6-tetrahydroindol-7-yl]-N-(3,4-difluorophenyl)sulfonylprop-2-enamide (PubChem CID 44571355) has the molecular formula C25H22Cl2F2N2O4S and a molecular weight of 555.43 g/mol. Its IUPAC name is (E)-3-[1-[(2,3-dichlorophenyl)methyl]-3a-methyl-2-oxo-3,4,5,6-tetrahydroindol-7-yl]-N-(3,4-difluorophenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-[1-[(2,3-dichlorophenyl)methyl]-3a-methyl-2-oxo-3,4,5,6-tetrahydroindol-7-yl]-N-(3,4-difluorophenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 44571355 |
| Molecular Formula | C25H22Cl2F2N2O4S |
| Molecular Weight | 555.43 g/mol |
| Exact Mass | 554.06 |
| IUPAC Name | (E)-3-[1-[(2,3-dichlorophenyl)methyl]-3a-methyl-2-oxo-3,4,5,6-tetrahydroindol-7-yl]-N-(3,4-difluorophenyl)sulfonylprop-2-enamide |
| SMILES | CC12CCCC(/C=C/C(=O)NS(=O)(=O)c3ccc(F)c(F)c3)=C1N(Cc1cccc(Cl)c1Cl)C(=O)C2 |
| InChI | InChI=1S/C25H22Cl2F2N2O4S/c1-25-11-3-5-15(7-10-21(32)30-36(34,35)17-8-9-19(28)20(29)12-17)24(25)31(22(33)13-25)14-16-4-2-6-18(26)23(16)27/h2,4,6-10,12H,3,5,11,13-14H2,1H3,(H,30,32)/b10-7+ |
| InChIKey | XOQTVCQBQJGVFG-JXMROGBWSA-N |
| XLogP | 5.51 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|