About benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate
benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate (PubChem CID 44571499) has the molecular formula C22H14Cl3N3O2
and a molecular weight of 458.73 g/mol. Its IUPAC name is benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate.
Molecular Properties
| Compound Name | benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate |
| PubChem CID | 44571499 |
| Molecular Formula | C22H14Cl3N3O2 |
| Molecular Weight | 458.73 g/mol |
| Exact Mass | 457.02 |
| IUPAC Name | benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)c1nnn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H14Cl3N3O2/c23-16-8-6-15(7-9-16)21-20(22(29)30-13-14-4-2-1-3-5-14)26-27-28(21)19-11-10-17(24)12-18(19)25/h1-12H,13H2 |
| InChIKey | XZIICELFYOCPCX-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.73 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate?
The IUPAC name of benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate (CID 44571499) is benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate.
What is the SMILES notation for benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate?
The canonical SMILES for benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate is O=C(OCc1ccccc1)c1nnn(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1.
What is the InChIKey of benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate?
The InChIKey is XZIICELFYOCPCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H14Cl3N3O2/c23-16-8-6-15(7-9-16)21-20(22(29)30-13-14-4-2-1-3-5-14)26-27-28(21)19-11-10-17(24)12-18(19)25/h1-12H,13H2.
What are the key properties of benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate?
benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate has a molecular weight of 458.73 g/mol, XLogP of 6.25, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 5-(4-chlorophenyl)-1-(2,4-dichlorophenyl)triazole-4-carboxylate is sourced from PubChem (CID 44571499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).