About 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide
5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide (PubChem CID 44571580) has the molecular formula C14H24ClNO3S2
and a molecular weight of 353.94 g/mol. Its IUPAC name is 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide |
| PubChem CID | 44571580 |
| Molecular Formula | C14H24ClNO3S2 |
| Molecular Weight | 353.94 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide |
| SMILES | CCCCCC[C@@H](C)[C@@H](CO)NS(=O)(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C14H24ClNO3S2/c1-3-4-5-6-7-11(2)12(10-17)16-21(18,19)14-9-8-13(15)20-14/h8-9,11-12,16-17H,3-7,10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | ZIORBIGDZZSVGN-VXGBXAGGSA-N |
| XLogP | 3.65 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.94 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide?
The IUPAC name of 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide (CID 44571580) is 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide.
What is the SMILES notation for 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide?
The canonical SMILES for 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide is CCCCCC[C@@H](C)[C@@H](CO)NS(=O)(=O)c1ccc(Cl)s1.
What is the InChIKey of 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide?
The InChIKey is ZIORBIGDZZSVGN-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H24ClNO3S2/c1-3-4-5-6-7-11(2)12(10-17)16-21(18,19)14-9-8-13(15)20-14/h8-9,11-12,16-17H,3-7,10H2,1-2H3/t11-,12-/m1/s1.
What are the key properties of 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide?
5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide has a molecular weight of 353.94 g/mol, XLogP of 3.65, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N-[(2S,3R)-1-hydroxy-3-methylnonan-2-yl]thiophene-2-sulfonamide is sourced from PubChem (CID 44571580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).