C33H41N3O2 — CID 44571582
(8R,12S)-21-cyclohexyl-9-(2-piperidin-1-ylethyl)-9,14-diazapentacyclo[12.7.0.02,7.08,12.015,20]henicosa-1(21),2,4,6,15(20),16,18-heptaene-17-carboxylic acid (PubChem CID 44571582) has the molecular formula C33H41N3O2 and a molecular weight of 511.71 g/mol. Its IUPAC name is (8R,12S)-21-cyclohexyl-9-(2-piperidin-1-ylethyl)-9,14-diazapentacyclo[12.7.0.02,7.08,12.015,20]henicosa-1(21),2,4,6,15(20),16,18-heptaene-17-carboxylic acid.
| Compound Name | (8R,12S)-21-cyclohexyl-9-(2-piperidin-1-ylethyl)-9,14-diazapentacyclo[12.7.0.02,7.08,12.015,20]henicosa-1(21),2,4,6,15(20),16,18-heptaene-17-carboxylic acid |
|---|---|
| PubChem CID | 44571582 |
| Molecular Formula | C33H41N3O2 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | (8R,12S)-21-cyclohexyl-9-(2-piperidin-1-ylethyl)-9,14-diazapentacyclo[12.7.0.02,7.08,12.015,20]henicosa-1(21),2,4,6,15(20),16,18-heptaene-17-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c3n(c2c1)C[C@@H]1CCN(CCN2CCCCC2)[C@H]1c1ccccc1-3 |
| InChI | InChI=1S/C33H41N3O2/c37-33(38)24-13-14-28-29(21-24)36-22-25-15-18-35(20-19-34-16-7-2-8-17-34)31(25)26-11-5-6-12-27(26)32(36)30(28)23-9-3-1-4-10-23/h5-6,11-14,21,23,25,31H,1-4,7-10,15-20,22H2,(H,37,38)/t25-,31+/m0/s1 |
| InChIKey | RQDLDUBHSZGLLJ-VVFBEHOQSA-N |
| XLogP | 6.92 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |