About S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate
S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate (PubChem CID 44571593) has the molecular formula C21H24N2OS2
and a molecular weight of 384.57 g/mol. Its IUPAC name is S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate.
Molecular Properties
| Compound Name | S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate |
| PubChem CID | 44571593 |
| Molecular Formula | C21H24N2OS2 |
| Molecular Weight | 384.57 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate |
| SMILES | CSC(=O)N1CC2(CCCCC2)CS/C1=N\c1cccc2ccccc12 |
| InChI | InChI=1S/C21H24N2OS2/c1-25-20(24)23-14-21(12-5-2-6-13-21)15-26-19(23)22-18-11-7-9-16-8-3-4-10-17(16)18/h3-4,7-11H,2,5-6,12-15H2,1H3/b22-19- |
| InChIKey | YDDYIKCCDDYARR-QOCHGBHMSA-N |
| XLogP | 6.31 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 384.57 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate?
The IUPAC name of S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate (CID 44571593) is S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate.
What is the SMILES notation for S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate?
The canonical SMILES for S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate is CSC(=O)N1CC2(CCCCC2)CS/C1=N\c1cccc2ccccc12.
What is the InChIKey of S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate?
The InChIKey is YDDYIKCCDDYARR-QOCHGBHMSA-N. The full InChI is InChI=1S/C21H24N2OS2/c1-25-20(24)23-14-21(12-5-2-6-13-21)15-26-19(23)22-18-11-7-9-16-8-3-4-10-17(16)18/h3-4,7-11H,2,5-6,12-15H2,1H3/b22-19-.
What are the key properties of S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate?
S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate has a molecular weight of 384.57 g/mol, XLogP of 6.31, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 3-naphthalen-1-ylimino-2-thia-4-azaspiro[5.5]undecane-4-carbothioate is sourced from PubChem (CID 44571593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).