About (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide
(5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide (PubChem CID 44571822) has the molecular formula C5H13BrN4
and a molecular weight of 209.09 g/mol. Its IUPAC name is (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide.
Molecular Properties
| Compound Name | (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide |
| PubChem CID | 44571822 |
| Molecular Formula | C5H13BrN4 |
| Molecular Weight | 209.09 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide |
| SMILES | Br.NCC[C@@H]1CN=C(N)N1 |
| InChI | InChI=1S/C5H12N4.BrH/c6-2-1-4-3-8-5(7)9-4;/h4H,1-3,6H2,(H3,7,8,9);1H/t4-;/m1./s1 |
| InChIKey | GAJWZZKBCYSCQL-PGMHMLKASA-N |
| XLogP | -0.80 |
| TPSA | 76.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.09 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide?
The IUPAC name of (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide (CID 44571822) is (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide.
What is the SMILES notation for (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide?
The canonical SMILES for (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide is Br.NCC[C@@H]1CN=C(N)N1.
What is the InChIKey of (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide?
The InChIKey is GAJWZZKBCYSCQL-PGMHMLKASA-N. The full InChI is InChI=1S/C5H12N4.BrH/c6-2-1-4-3-8-5(7)9-4;/h4H,1-3,6H2,(H3,7,8,9);1H/t4-;/m1./s1.
What are the key properties of (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide?
(5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide has a molecular weight of 209.09 g/mol, XLogP of -0.80, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-(2-aminoethyl)-4,5-dihydro-1H-imidazol-2-amine;hydrobromide is sourced from PubChem (CID 44571822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).