About 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine
2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine (PubChem CID 44571829) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine |
| PubChem CID | 44571829 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine |
| SMILES | CC1=NC[C@H](CCN)N1 |
| InChI | InChI=1S/C6H13N3/c1-5-8-4-6(9-5)2-3-7/h6H,2-4,7H2,1H3,(H,8,9)/t6-/m0/s1 |
| InChIKey | PZLRTDPWECBARE-LURJTMIESA-N |
| XLogP | -0.27 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine?
The IUPAC name of 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine (CID 44571829) is 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine.
What is the SMILES notation for 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine?
The canonical SMILES for 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine is CC1=NC[C@H](CCN)N1.
What is the InChIKey of 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine?
The InChIKey is PZLRTDPWECBARE-LURJTMIESA-N. The full InChI is InChI=1S/C6H13N3/c1-5-8-4-6(9-5)2-3-7/h6H,2-4,7H2,1H3,(H,8,9)/t6-/m0/s1.
What are the key properties of 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine?
2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine has a molecular weight of 127.19 g/mol, XLogP of -0.27, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5S)-2-methyl-4,5-dihydro-1H-imidazol-5-yl]ethanamine is sourced from PubChem (CID 44571829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).