C15H18N2O — CID 44571842
2-[4-(ethoxymethyl)-2,3-dihydro-1H-inden-1-yl]-1H-imidazole (PubChem CID 44571842) has the molecular formula C15H18N2O and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-[4-(ethoxymethyl)-2,3-dihydro-1H-inden-1-yl]-1H-imidazole.
| Compound Name | 2-[4-(ethoxymethyl)-2,3-dihydro-1H-inden-1-yl]-1H-imidazole |
|---|---|
| PubChem CID | 44571842 |
| Molecular Formula | C15H18N2O |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | 2-[4-(ethoxymethyl)-2,3-dihydro-1H-inden-1-yl]-1H-imidazole |
| SMILES | CCOCc1cccc2c1CCC2c1ncc[nH]1 |
| InChI | InChI=1S/C15H18N2O/c1-2-18-10-11-4-3-5-13-12(11)6-7-14(13)15-16-8-9-17-15/h3-5,8-9,14H,2,6-7,10H2,1H3,(H,16,17) |
| InChIKey | VNPMWPRPDVXRGM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |