C23H25ClF3N3O4 — CID 44571896
4-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,4-diazepane-1-carbonyl]benzoic acid;hydrochloride (PubChem CID 44571896) has the molecular formula C23H25ClF3N3O4 and a molecular weight of 499.92 g/mol. Its IUPAC name is 4-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,4-diazepane-1-carbonyl]benzoic acid;hydrochloride.
| Compound Name | 4-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,4-diazepane-1-carbonyl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 44571896 |
| Molecular Formula | C23H25ClF3N3O4 |
| Molecular Weight | 499.92 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 4-[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,4-diazepane-1-carbonyl]benzoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)N1CCCN(C(=O)c2ccc(C(=O)O)cc2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H24F3N3O4.ClH/c24-18-13-20(26)19(25)11-16(18)10-17(27)12-21(30)28-6-1-7-29(9-8-28)22(31)14-2-4-15(5-3-14)23(32)33;/h2-5,11,13,17H,1,6-10,12,27H2,(H,32,33);1H/t17-;/m1./s1 |
| InChIKey | OOOLWVYCRNDJHE-UNTBIKODSA-N |
| XLogP | 2.86 |
| TPSA | 103.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.92 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|