C23H26ClF3N4O4 — CID 44571899
4-[[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,4-diazepane-1-carbonyl]amino]benzoic acid;hydrochloride (PubChem CID 44571899) has the molecular formula C23H26ClF3N4O4 and a molecular weight of 514.93 g/mol. Its IUPAC name is 4-[[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,4-diazepane-1-carbonyl]amino]benzoic acid;hydrochloride.
| Compound Name | 4-[[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,4-diazepane-1-carbonyl]amino]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 44571899 |
| Molecular Formula | C23H26ClF3N4O4 |
| Molecular Weight | 514.93 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 4-[[4-[(3R)-3-amino-4-(2,4,5-trifluorophenyl)butanoyl]-1,4-diazepane-1-carbonyl]amino]benzoic acid;hydrochloride |
| SMILES | Cl.N[C@@H](CC(=O)N1CCCN(C(=O)Nc2ccc(C(=O)O)cc2)CC1)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C23H25F3N4O4.ClH/c24-18-13-20(26)19(25)11-15(18)10-16(27)12-21(31)29-6-1-7-30(9-8-29)23(34)28-17-4-2-14(3-5-17)22(32)33;/h2-5,11,13,16H,1,6-10,12,27H2,(H,28,34)(H,32,33);1H/t16-;/m1./s1 |
| InChIKey | CVGITWBEPISOPT-PKLMIRHRSA-N |
| XLogP | 3.25 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.93 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|