C29H28ClNO6 — CID 44571977
21-[(3,5-dimethoxyphenyl)methyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride (PubChem CID 44571977) has the molecular formula C29H28ClNO6 and a molecular weight of 522.00 g/mol. Its IUPAC name is 21-[(3,5-dimethoxyphenyl)methyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride.
| Compound Name | 21-[(3,5-dimethoxyphenyl)methyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride |
|---|---|
| PubChem CID | 44571977 |
| Molecular Formula | C29H28ClNO6 |
| Molecular Weight | 522.00 g/mol |
| Exact Mass | 521.16 |
| IUPAC Name | 21-[(3,5-dimethoxyphenyl)methyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene chloride |
| SMILES | COc1cc(Cc2c3[n+](cc4c(OC)c(OC)ccc24)CCc2cc4c(cc2-3)OCO4)cc(OC)c1.[Cl-] |
| InChI | InChI=1S/C29H28NO6.ClH/c1-31-19-9-17(10-20(13-19)32-2)11-23-21-5-6-25(33-3)29(34-4)24(21)15-30-8-7-18-12-26-27(36-16-35-26)14-22(18)28(23)30;/h5-6,9-10,12-15H,7-8,11,16H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | BWSIJTDBBMJDQC-UHFFFAOYSA-M |
| XLogP | 1.71 |
| TPSA | 59.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.00 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|