C30H29F3NO4+ — CID 44572021
13-ethyl-2,3,10-trimethoxy-9-[[2-(trifluoromethyl)phenyl]methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium (PubChem CID 44572021) has the molecular formula C30H29F3NO4+ and a molecular weight of 524.56 g/mol. Its IUPAC name is 13-ethyl-2,3,10-trimethoxy-9-[[2-(trifluoromethyl)phenyl]methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium.
| Compound Name | 13-ethyl-2,3,10-trimethoxy-9-[[2-(trifluoromethyl)phenyl]methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
|---|---|
| PubChem CID | 44572021 |
| Molecular Formula | C30H29F3NO4+ |
| Molecular Weight | 524.56 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 13-ethyl-2,3,10-trimethoxy-9-[[2-(trifluoromethyl)phenyl]methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium |
| SMILES | CCc1c2[n+](cc3c(OCc4ccccc4C(F)(F)F)c(OC)ccc13)CCc1cc(OC)c(OC)cc1-2 |
| InChI | InChI=1S/C30H29F3NO4/c1-5-20-21-10-11-25(35-2)29(38-17-19-8-6-7-9-24(19)30(31,32)33)23(21)16-34-13-12-18-14-26(36-3)27(37-4)15-22(18)28(20)34/h6-11,14-16H,5,12-13,17H2,1-4H3/q+1 |
| InChIKey | YDDHNMIORJRHNK-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.56 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|