C26H40N4O5 — CID 44572034
(3S,6S,9S,12S)-3-benzyl-9-sec-butyl-6-((2S,3R)-3-hydroxybutan-2-yl)-12-isopropyl-1,4,7,10-tetraazacyclododecane-2,5,8,11-tetraone (PubChem CID 44572034) has the molecular formula C26H40N4O5 and a molecular weight of 488.60 g/mol. Its IUPAC name is (3S,6S,9S,12S)-3-benzyl-9-[(2S)-butan-2-yl]-6-[(2S,3R)-3-hydroxybutan-2-yl]-12-propan-2-yl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone.
| Compound Name | (3S,6S,9S,12S)-3-benzyl-9-sec-butyl-6-((2S,3R)-3-hydroxybutan-2-yl)-12-isopropyl-1,4,7,10-tetraazacyclododecane-2,5,8,11-tetraone |
|---|---|
| PubChem CID | 44572034 |
| Molecular Formula | C26H40N4O5 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.30 |
| IUPAC Name | (3S,6S,9S,12S)-3-benzyl-9-[(2S)-butan-2-yl]-6-[(2S,3R)-3-hydroxybutan-2-yl]-12-propan-2-yl-1,4,7,10-tetrazacyclododecane-2,5,8,11-tetrone |
| SMILES | CC[C@H](C)[C@H]1C(=O)N[C@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N1)C(C)C)CC2=CC=CC=C2)[C@H](C)[C@@H](C)O |
| InChI | InChI=1S/C26H40N4O5/c1-7-15(4)21-25(34)30-22(16(5)17(6)31)26(35)27-19(13-18-11-9-8-10-12-18)23(32)28-20(14(2)3)24(33)29-21/h8-12,14-17,19-22,31H,7,13H2,1-6H3,(H,27,35)(H,28,32)(H,29,33)(H,30,34)/t15-,16+,17+,19-,20-,21-,22-/m0/s1 |
| InChIKey | ZWHILRBVKJAMNY-FELOTHHLSA-N |
| XLogP | 3.00 |
| TPSA | 137.00 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | 752 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |