C20H30O3 — CID 44572049
3-[2-[(1R,2S,3R,4aR,8aR)-3-hydroxy-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one (PubChem CID 44572049) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 3-[2-[(1R,2S,3R,4aR,8aR)-3-hydroxy-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one.
| Compound Name | 3-[2-[(1R,2S,3R,4aR,8aR)-3-hydroxy-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 44572049 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 3-[2-[(1R,2S,3R,4aR,8aR)-3-hydroxy-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethyl]-2H-furan-5-one |
| SMILES | CC1=CCC[C@@H]2[C@@](C)(CCC3=CC(=O)OC3)[C@H](C)[C@H](O)C[C@@]12C |
| InChI | InChI=1S/C20H30O3/c1-13-6-5-7-17-19(3,9-8-15-10-18(22)23-12-15)14(2)16(21)11-20(13,17)4/h6,10,14,16-17,21H,5,7-9,11-12H2,1-4H3/t14-,16-,17-,19+,20+/m1/s1 |
| InChIKey | ZDVLGKCINKLWMH-NQAGYIRISA-N |
| XLogP | 4.02 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|