C30H34O4 — CID 44572096
2-[(1S)-6-[[4-(2-butoxy-5-methylphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid (PubChem CID 44572096) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is 2-[(1S)-6-[[4-(2-butoxy-5-methylphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid.
| Compound Name | 2-[(1S)-6-[[4-(2-butoxy-5-methylphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid |
|---|---|
| PubChem CID | 44572096 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 2-[(1S)-6-[[4-(2-butoxy-5-methylphenyl)phenyl]methoxy]-1,2,3,4-tetrahydronaphthalen-1-yl]acetic acid |
| SMILES | CCCCOc1ccc(C)cc1-c1ccc(COc2ccc3c(c2)CCC[C@H]3CC(=O)O)cc1 |
| InChI | InChI=1S/C30H34O4/c1-3-4-16-33-29-15-8-21(2)17-28(29)23-11-9-22(10-12-23)20-34-26-13-14-27-24(18-26)6-5-7-25(27)19-30(31)32/h8-15,17-18,25H,3-7,16,19-20H2,1-2H3,(H,31,32)/t25-/m0/s1 |
| InChIKey | DCTJXVVBXQEBIQ-VWLOTQADSA-N |
| XLogP | 7.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|