C36H36INO5 — CID 44572130
13-ethyl-2,3,10-trimethoxy-9-[(4-phenylmethoxyphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide (PubChem CID 44572130) has the molecular formula C36H36INO5 and a molecular weight of 689.59 g/mol. Its IUPAC name is 13-ethyl-2,3,10-trimethoxy-9-[(4-phenylmethoxyphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide.
| Compound Name | 13-ethyl-2,3,10-trimethoxy-9-[(4-phenylmethoxyphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide |
|---|---|
| PubChem CID | 44572130 |
| Molecular Formula | C36H36INO5 |
| Molecular Weight | 689.59 g/mol |
| Exact Mass | 689.16 |
| IUPAC Name | 13-ethyl-2,3,10-trimethoxy-9-[(4-phenylmethoxyphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium iodide |
| SMILES | CCc1c2[n+](cc3c(OCc4ccc(OCc5ccccc5)cc4)c(OC)ccc13)CCc1cc(OC)c(OC)cc1-2.[I-] |
| InChI | InChI=1S/C36H36NO5.HI/c1-5-28-29-15-16-32(38-2)36(42-23-25-11-13-27(14-12-25)41-22-24-9-7-6-8-10-24)31(29)21-37-18-17-26-19-33(39-3)34(40-4)20-30(26)35(28)37;/h6-16,19-21H,5,17-18,22-23H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | HFNBMYWDQJLWCM-UHFFFAOYSA-M |
| XLogP | 4.10 |
| TPSA | 50.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.59 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|